C9H11N5O2S2 — CID 112675187
2-amino-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzenesulfonamide (PubChem CID 112675187) has the molecular formula C9H11N5O2S2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-amino-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzenesulfonamide.
| Compound Name | 2-amino-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112675187 |
| Molecular Formula | C9H11N5O2S2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2-amino-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]benzenesulfonamide |
| SMILES | Cc1nc(Sc2cccc(S(N)(=O)=O)c2N)n[nH]1 |
| InChI | InChI=1S/C9H11N5O2S2/c1-5-12-9(14-13-5)17-6-3-2-4-7(8(6)10)18(11,15)16/h2-4H,10H2,1H3,(H2,11,15,16)(H,12,13,14) |
| InChIKey | ZZGBRGWLHYCDAX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|