C10H10F2N2O — CID 112675461
1-(3,5-difluoro-2-pyridinyl)piperidin-3-one (PubChem CID 112675461) has the molecular formula C10H10F2N2O and a molecular weight of 212.20 g/mol. Its IUPAC name is 1-(3,5-difluoro-2-pyridinyl)piperidin-3-one.
| Compound Name | 1-(3,5-difluoro-2-pyridinyl)piperidin-3-one |
|---|---|
| PubChem CID | 112675461 |
| Molecular Formula | C10H10F2N2O |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 1-(3,5-difluoro-2-pyridinyl)piperidin-3-one |
| SMILES | O=C1CCCN(c2ncc(F)cc2F)C1 |
| InChI | InChI=1S/C10H10F2N2O/c11-7-4-9(12)10(13-5-7)14-3-1-2-8(15)6-14/h4-5H,1-3,6H2 |
| InChIKey | XYRVZCPIXCOSTJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |