C13H18F2N2 — CID 112675822
N-(1-cyclohexylethyl)-3,5-difluoropyridin-2-amine (PubChem CID 112675822) has the molecular formula C13H18F2N2 and a molecular weight of 240.30 g/mol. Its IUPAC name is N-(1-cyclohexylethyl)-3,5-difluoropyridin-2-amine.
| Compound Name | N-(1-cyclohexylethyl)-3,5-difluoropyridin-2-amine |
|---|---|
| PubChem CID | 112675822 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N-(1-cyclohexylethyl)-3,5-difluoropyridin-2-amine |
| SMILES | CC(Nc1ncc(F)cc1F)C1CCCCC1 |
| InChI | InChI=1S/C13H18F2N2/c1-9(10-5-3-2-4-6-10)17-13-12(15)7-11(14)8-16-13/h7-10H,2-6H2,1H3,(H,16,17) |
| InChIKey | GCUFXOSYIXEKRP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |