C11H7ClF2N2O — CID 112676066
4-chloro-3-[(3,5-difluoro-2-pyridinyl)oxy]aniline (PubChem CID 112676066) has the molecular formula C11H7ClF2N2O and a molecular weight of 256.64 g/mol. Its IUPAC name is 4-chloro-3-[(3,5-difluoro-2-pyridinyl)oxy]aniline.
| Compound Name | 4-chloro-3-[(3,5-difluoro-2-pyridinyl)oxy]aniline |
|---|---|
| PubChem CID | 112676066 |
| Molecular Formula | C11H7ClF2N2O |
| Molecular Weight | 256.64 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 4-chloro-3-[(3,5-difluoro-2-pyridinyl)oxy]aniline |
| SMILES | Nc1ccc(Cl)c(Oc2ncc(F)cc2F)c1 |
| InChI | InChI=1S/C11H7ClF2N2O/c12-8-2-1-7(15)4-10(8)17-11-9(14)3-6(13)5-16-11/h1-5H,15H2 |
| InChIKey | LYUYOPQCIRKOMP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.64 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|