C14H21F2N3 — CID 112676467
N-[[1-(3,5-difluoro-2-pyridinyl)piperidin-4-yl]methyl]propan-1-amine (PubChem CID 112676467) has the molecular formula C14H21F2N3 and a molecular weight of 269.34 g/mol. Its IUPAC name is N-[[1-(3,5-difluoro-2-pyridinyl)piperidin-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(3,5-difluoro-2-pyridinyl)piperidin-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 112676467 |
| Molecular Formula | C14H21F2N3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | N-[[1-(3,5-difluoro-2-pyridinyl)piperidin-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCN(c2ncc(F)cc2F)CC1 |
| InChI | InChI=1S/C14H21F2N3/c1-2-5-17-9-11-3-6-19(7-4-11)14-13(16)8-12(15)10-18-14/h8,10-11,17H,2-7,9H2,1H3 |
| InChIKey | LELGBJHDZDTPAW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|