C17H20FN — CID 112676883
N-[1-(2-fluorophenyl)propyl]-2,5-dimethylaniline (PubChem CID 112676883) has the molecular formula C17H20FN and a molecular weight of 257.35 g/mol. Its IUPAC name is N-[1-(2-fluorophenyl)propyl]-2,5-dimethylaniline.
| Compound Name | N-[1-(2-fluorophenyl)propyl]-2,5-dimethylaniline |
|---|---|
| PubChem CID | 112676883 |
| Molecular Formula | C17H20FN |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-[1-(2-fluorophenyl)propyl]-2,5-dimethylaniline |
| SMILES | CCC(Nc1cc(C)ccc1C)c1ccccc1F |
| InChI | InChI=1S/C17H20FN/c1-4-16(14-7-5-6-8-15(14)18)19-17-11-12(2)9-10-13(17)3/h5-11,16,19H,4H2,1-3H3 |
| InChIKey | NWVZZANACGZTIB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |