About 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclohexylurea
3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclohexylurea (PubChem CID 11267851) has the molecular formula C16H24ClN3OS
and a molecular weight of 341.91 g/mol. Its IUPAC name is 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclohexylurea.
Molecular Properties
| Compound Name | 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclohexylurea |
| PubChem CID | 11267851 |
| Molecular Formula | C16H24ClN3OS |
| Molecular Weight | 341.91 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclohexylurea |
| SMILES | O=C(Nc1ncc(Cl)s1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H24ClN3OS/c17-14-11-18-15(22-14)19-16(21)20(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h11-13H,1-10H2,(H,18,19,21) |
| InChIKey | QHASMBBHKRPFJJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.91 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclohexylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclohexylurea?
The IUPAC name of 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclohexylurea (CID 11267851) is 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclohexylurea.
What is the SMILES notation for 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclohexylurea?
The canonical SMILES for 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclohexylurea is O=C(Nc1ncc(Cl)s1)N(C1CCCCC1)C1CCCCC1.
What is the InChIKey of 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclohexylurea?
The InChIKey is QHASMBBHKRPFJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24ClN3OS/c17-14-11-18-15(22-14)19-16(21)20(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h11-13H,1-10H2,(H,18,19,21).
What are the key properties of 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclohexylurea?
3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclohexylurea has a molecular weight of 341.91 g/mol, XLogP of 5.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-1,3-thiazol-2-yl)-1,1-dicyclohexylurea is sourced from PubChem (CID 11267851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).