C18H12F2N2OS — CID 11267866
2,3-bis(4-fluorophenyl)-6,7-dihydroimidazo[2,1-b][1,3]thiazin-5-one (PubChem CID 11267866) has the molecular formula C18H12F2N2OS and a molecular weight of 342.37 g/mol. Its IUPAC name is 2,3-bis(4-fluorophenyl)-6,7-dihydroimidazo[2,1-b][1,3]thiazin-5-one.
| Compound Name | 2,3-bis(4-fluorophenyl)-6,7-dihydroimidazo[2,1-b][1,3]thiazin-5-one |
|---|---|
| PubChem CID | 11267866 |
| Molecular Formula | C18H12F2N2OS |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2,3-bis(4-fluorophenyl)-6,7-dihydroimidazo[2,1-b][1,3]thiazin-5-one |
| SMILES | O=C1CCSc2nc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)n21 |
| InChI | InChI=1S/C18H12F2N2OS/c19-13-5-1-11(2-6-13)16-17(12-3-7-14(20)8-4-12)22-15(23)9-10-24-18(22)21-16/h1-8H,9-10H2 |
| InChIKey | LKOSVCGVGJEUIT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |