C14H22FN — CID 112680293
4-(2-fluorophenyl)-N,2-dimethylhexan-3-amine (PubChem CID 112680293) has the molecular formula C14H22FN and a molecular weight of 223.34 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N,2-dimethylhexan-3-amine.
| Compound Name | 4-(2-fluorophenyl)-N,2-dimethylhexan-3-amine |
|---|---|
| PubChem CID | 112680293 |
| Molecular Formula | C14H22FN |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 4-(2-fluorophenyl)-N,2-dimethylhexan-3-amine |
| SMILES | CCC(c1ccccc1F)C(NC)C(C)C |
| InChI | InChI=1S/C14H22FN/c1-5-11(14(16-4)10(2)3)12-8-6-7-9-13(12)15/h6-11,14,16H,5H2,1-4H3 |
| InChIKey | HIWDUCFJEXJARF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |