C8H13N5O — CID 112681350
6-(oxolan-2-ylmethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 112681350) has the molecular formula C8H13N5O and a molecular weight of 195.23 g/mol. Its IUPAC name is 6-(oxolan-2-ylmethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(oxolan-2-ylmethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112681350 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 6-(oxolan-2-ylmethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(CC2CCCO2)n1 |
| InChI | InChI=1S/C8H13N5O/c9-7-11-6(12-8(10)13-7)4-5-2-1-3-14-5/h5H,1-4H2,(H4,9,10,11,12,13) |
| InChIKey | OVARPVUNAULONC-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |