C9H6ClF2N5 — CID 112681372
6-(4-chloro-2,5-difluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 112681372) has the molecular formula C9H6ClF2N5 and a molecular weight of 257.63 g/mol. Its IUPAC name is 6-(4-chloro-2,5-difluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(4-chloro-2,5-difluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112681372 |
| Molecular Formula | C9H6ClF2N5 |
| Molecular Weight | 257.63 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 6-(4-chloro-2,5-difluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2cc(F)c(Cl)cc2F)n1 |
| InChI | InChI=1S/C9H6ClF2N5/c10-4-2-5(11)3(1-6(4)12)7-15-8(13)17-9(14)16-7/h1-2H,(H4,13,14,15,16,17) |
| InChIKey | MGOUUAKFRFUTHO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.63 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|