About S-phenyl (2S,3R)-3-hydroxy-2-methyl-12-oxotridecanethioate
S-phenyl (2S,3R)-3-hydroxy-2-methyl-12-oxotridecanethioate (PubChem CID 11268149) has the molecular formula C20H30O3S
and a molecular weight of 350.52 g/mol. Its IUPAC name is S-phenyl (2S,3R)-3-hydroxy-2-methyl-12-oxotridecanethioate.
Molecular Properties
| Compound Name | S-phenyl (2S,3R)-3-hydroxy-2-methyl-12-oxotridecanethioate |
| PubChem CID | 11268149 |
| Molecular Formula | C20H30O3S |
| Molecular Weight | 350.52 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | S-phenyl (2S,3R)-3-hydroxy-2-methyl-12-oxotridecanethioate |
| SMILES | CC(=O)CCCCCCCC[C@@H](O)[C@H](C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C20H30O3S/c1-16(21)12-8-5-3-4-6-11-15-19(22)17(2)20(23)24-18-13-9-7-10-14-18/h7,9-10,13-14,17,19,22H,3-6,8,11-12,15H2,1-2H3/t17-,19+/m0/s1 |
| InChIKey | WHTKSYLJVKFZNH-PKOBYXMFSA-N |
| XLogP | 5.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenyl (2S,3R)-3-hydroxy-2-methyl-12-oxotridecanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenyl (2S,3R)-3-hydroxy-2-methyl-12-oxotridecanethioate?
The IUPAC name of S-phenyl (2S,3R)-3-hydroxy-2-methyl-12-oxotridecanethioate (CID 11268149) is S-phenyl (2S,3R)-3-hydroxy-2-methyl-12-oxotridecanethioate.
What is the SMILES notation for S-phenyl (2S,3R)-3-hydroxy-2-methyl-12-oxotridecanethioate?
The canonical SMILES for S-phenyl (2S,3R)-3-hydroxy-2-methyl-12-oxotridecanethioate is CC(=O)CCCCCCCC[C@@H](O)[C@H](C)C(=O)Sc1ccccc1.
What is the InChIKey of S-phenyl (2S,3R)-3-hydroxy-2-methyl-12-oxotridecanethioate?
The InChIKey is WHTKSYLJVKFZNH-PKOBYXMFSA-N. The full InChI is InChI=1S/C20H30O3S/c1-16(21)12-8-5-3-4-6-11-15-19(22)17(2)20(23)24-18-13-9-7-10-14-18/h7,9-10,13-14,17,19,22H,3-6,8,11-12,15H2,1-2H3/t17-,19+/m0/s1.
What are the key properties of S-phenyl (2S,3R)-3-hydroxy-2-methyl-12-oxotridecanethioate?
S-phenyl (2S,3R)-3-hydroxy-2-methyl-12-oxotridecanethioate has a molecular weight of 350.52 g/mol, XLogP of 5.01, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenyl (2S,3R)-3-hydroxy-2-methyl-12-oxotridecanethioate is sourced from PubChem (CID 11268149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).