C5H5N7S — CID 112681501
6-(thiadiazol-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 112681501) has the molecular formula C5H5N7S and a molecular weight of 195.21 g/mol. Its IUPAC name is 6-(thiadiazol-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(thiadiazol-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112681501 |
| Molecular Formula | C5H5N7S |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 6-(thiadiazol-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2csnn2)n1 |
| InChI | InChI=1S/C5H5N7S/c6-4-8-3(9-5(7)10-4)2-1-13-12-11-2/h1H,(H4,6,7,8,9,10) |
| InChIKey | UEINBYXMKVAEBL-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |