C12H13N5 — CID 112681528
6-(1-phenylcyclopropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 112681528) has the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. Its IUPAC name is 6-(1-phenylcyclopropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1-phenylcyclopropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112681528 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 6-(1-phenylcyclopropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(C2(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C12H13N5/c13-10-15-9(16-11(14)17-10)12(6-7-12)8-4-2-1-3-5-8/h1-5H,6-7H2,(H4,13,14,15,16,17) |
| InChIKey | KPUQKEYRKBUFEW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |