C9H15N5 — CID 112681544
6-(1-methylcyclopentyl)-1,3,5-triazine-2,4-diamine (PubChem CID 112681544) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is 6-(1-methylcyclopentyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1-methylcyclopentyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112681544 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 6-(1-methylcyclopentyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(c2nc(N)nc(N)n2)CCCC1 |
| InChI | InChI=1S/C9H15N5/c1-9(4-2-3-5-9)6-12-7(10)14-8(11)13-6/h2-5H2,1H3,(H4,10,11,12,13,14) |
| InChIKey | VAEVOHAZJWUQBJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |