C21H18FNO3 — CID 11268166
(4-fluorophenyl) 4-methyl-3-oxo-1,2,5,6-tetrahydrobenzo[c]quinolizine-8-carboxylate (PubChem CID 11268166) has the molecular formula C21H18FNO3 and a molecular weight of 351.38 g/mol. Its IUPAC name is (4-fluorophenyl) 4-methyl-3-oxo-1,2,5,6-tetrahydrobenzo[c]quinolizine-8-carboxylate.
| Compound Name | (4-fluorophenyl) 4-methyl-3-oxo-1,2,5,6-tetrahydrobenzo[c]quinolizine-8-carboxylate |
|---|---|
| PubChem CID | 11268166 |
| Molecular Formula | C21H18FNO3 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (4-fluorophenyl) 4-methyl-3-oxo-1,2,5,6-tetrahydrobenzo[c]quinolizine-8-carboxylate |
| SMILES | CC1=C2CCc3cc(C(=O)Oc4ccc(F)cc4)ccc3N2CCC1=O |
| InChI | InChI=1S/C21H18FNO3/c1-13-18-8-2-14-12-15(3-9-19(14)23(18)11-10-20(13)24)21(25)26-17-6-4-16(22)5-7-17/h3-7,9,12H,2,8,10-11H2,1H3 |
| InChIKey | FALGKTJUEOJLQJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|