C16H23Cl2N — CID 112681827
2,4-dichloro-N-(3,3,5,5-tetramethylcyclohexyl)aniline (PubChem CID 112681827) has the molecular formula C16H23Cl2N and a molecular weight of 300.27 g/mol. Its IUPAC name is 2,4-dichloro-N-(3,3,5,5-tetramethylcyclohexyl)aniline.
| Compound Name | 2,4-dichloro-N-(3,3,5,5-tetramethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 112681827 |
| Molecular Formula | C16H23Cl2N |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2,4-dichloro-N-(3,3,5,5-tetramethylcyclohexyl)aniline |
| SMILES | CC1(C)CC(Nc2ccc(Cl)cc2Cl)CC(C)(C)C1 |
| InChI | InChI=1S/C16H23Cl2N/c1-15(2)8-12(9-16(3,4)10-15)19-14-6-5-11(17)7-13(14)18/h5-7,12,19H,8-10H2,1-4H3 |
| InChIKey | CVCFLGKOFWWVEZ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |