C16H24BrN — CID 112681853
3-bromo-N-(3,3,5,5-tetramethylcyclohexyl)aniline (PubChem CID 112681853) has the molecular formula C16H24BrN and a molecular weight of 310.28 g/mol. Its IUPAC name is 3-bromo-N-(3,3,5,5-tetramethylcyclohexyl)aniline.
| Compound Name | 3-bromo-N-(3,3,5,5-tetramethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 112681853 |
| Molecular Formula | C16H24BrN |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 3-bromo-N-(3,3,5,5-tetramethylcyclohexyl)aniline |
| SMILES | CC1(C)CC(Nc2cccc(Br)c2)CC(C)(C)C1 |
| InChI | InChI=1S/C16H24BrN/c1-15(2)9-14(10-16(3,4)11-15)18-13-7-5-6-12(17)8-13/h5-8,14,18H,9-11H2,1-4H3 |
| InChIKey | GKRZVTHNEQZTIW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |