C15H28N2 — CID 112682097
3-[(3,3,5,5-tetramethylcyclohexyl)amino]pentanenitrile (PubChem CID 112682097) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 3-[(3,3,5,5-tetramethylcyclohexyl)amino]pentanenitrile.
| Compound Name | 3-[(3,3,5,5-tetramethylcyclohexyl)amino]pentanenitrile |
|---|---|
| PubChem CID | 112682097 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 3-[(3,3,5,5-tetramethylcyclohexyl)amino]pentanenitrile |
| SMILES | CCC(CC#N)NC1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C15H28N2/c1-6-12(7-8-16)17-13-9-14(2,3)11-15(4,5)10-13/h12-13,17H,6-7,9-11H2,1-5H3 |
| InChIKey | YDXIGABKKAIMAO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |