C13H22N4O2 — CID 112682286
4-nitro-1-(3,3,5,5-tetramethylcyclohexyl)pyrazol-5-amine (PubChem CID 112682286) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-nitro-1-(3,3,5,5-tetramethylcyclohexyl)pyrazol-5-amine.
| Compound Name | 4-nitro-1-(3,3,5,5-tetramethylcyclohexyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 112682286 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 4-nitro-1-(3,3,5,5-tetramethylcyclohexyl)pyrazol-5-amine |
| SMILES | CC1(C)CC(n2ncc([N+](=O)[O-])c2N)CC(C)(C)C1 |
| InChI | InChI=1S/C13H22N4O2/c1-12(2)5-9(6-13(3,4)8-12)16-11(14)10(7-15-16)17(18)19/h7,9H,5-6,8,14H2,1-4H3 |
| InChIKey | UPGVLFWSXDPDLT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|