C18H18Cl2FNO — CID 11268230
N-[[7-(2,6-dichlorophenyl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]propan-1-amine (PubChem CID 11268230) has the molecular formula C18H18Cl2FNO and a molecular weight of 354.25 g/mol. Its IUPAC name is N-[[7-(2,6-dichlorophenyl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[7-(2,6-dichlorophenyl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 11268230 |
| Molecular Formula | C18H18Cl2FNO |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | N-[[7-(2,6-dichlorophenyl)-5-fluoro-2,3-dihydro-1-benzofuran-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1Cc2cc(F)cc(-c3c(Cl)cccc3Cl)c2O1 |
| InChI | InChI=1S/C18H18Cl2FNO/c1-2-6-22-10-13-8-11-7-12(21)9-14(18(11)23-13)17-15(19)4-3-5-16(17)20/h3-5,7,9,13,22H,2,6,8,10H2,1H3 |
| InChIKey | OCIHNHCDAKUZPA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|