C14H25N5 — CID 112682425
1-(3-azidopropylamino)-3,3,5,5-tetramethylcyclohexane-1-carbonitrile (PubChem CID 112682425) has the molecular formula C14H25N5 and a molecular weight of 263.39 g/mol. Its IUPAC name is 1-(3-azidopropylamino)-3,3,5,5-tetramethylcyclohexane-1-carbonitrile.
| Compound Name | 1-(3-azidopropylamino)-3,3,5,5-tetramethylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 112682425 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 1-(3-azidopropylamino)-3,3,5,5-tetramethylcyclohexane-1-carbonitrile |
| SMILES | CC1(C)CC(C)(C)CC(C#N)(NCCCN=[N+]=[N-])C1 |
| InChI | InChI=1S/C14H25N5/c1-12(2)8-13(3,4)10-14(9-12,11-15)17-6-5-7-18-19-16/h17H,5-10H2,1-4H3 |
| InChIKey | XYHZLBHGFFMTIR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|