C19H38O2Si2 — CID 11268255
tert-butyl-[[(1R,2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2-bicyclo[3.2.0]hept-6-enyl]oxy]-dimethylsilane (PubChem CID 11268255) has the molecular formula C19H38O2Si2 and a molecular weight of 354.68 g/mol. Its IUPAC name is tert-butyl-[[(1R,2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2-bicyclo[3.2.0]hept-6-enyl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2-bicyclo[3.2.0]hept-6-enyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11268255 |
| Molecular Formula | C19H38O2Si2 |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | tert-butyl-[[(1R,2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-2-bicyclo[3.2.0]hept-6-enyl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C=C[C@@H]21 |
| InChI | InChI=1S/C19H38O2Si2/c1-18(2,3)22(7,8)20-16-13-17(15-12-11-14(15)16)21-23(9,10)19(4,5)6/h11-12,14-17H,13H2,1-10H3/t14-,15+,16-,17+ |
| InChIKey | LLCLUNWXSHLTCA-WNKDZCFJSA-N |
| XLogP | 5.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|