C15H30N2 — CID 112682558
3-methyl-1-(3,3,5,5-tetramethylcyclohexyl)piperazine (PubChem CID 112682558) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is 3-methyl-1-(3,3,5,5-tetramethylcyclohexyl)piperazine.
| Compound Name | 3-methyl-1-(3,3,5,5-tetramethylcyclohexyl)piperazine |
|---|---|
| PubChem CID | 112682558 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 3-methyl-1-(3,3,5,5-tetramethylcyclohexyl)piperazine |
| SMILES | CC1CN(C2CC(C)(C)CC(C)(C)C2)CCN1 |
| InChI | InChI=1S/C15H30N2/c1-12-10-17(7-6-16-12)13-8-14(2,3)11-15(4,5)9-13/h12-13,16H,6-11H2,1-5H3 |
| InChIKey | SGANZAOCVOZWHU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |