C14H28O — CID 112682685
1-butan-2-yl-3,3,5,5-tetramethylcyclohexan-1-ol (PubChem CID 112682685) has the molecular formula C14H28O and a molecular weight of 212.38 g/mol. Its IUPAC name is 1-butan-2-yl-3,3,5,5-tetramethylcyclohexan-1-ol.
| Compound Name | 1-butan-2-yl-3,3,5,5-tetramethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 112682685 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 1-butan-2-yl-3,3,5,5-tetramethylcyclohexan-1-ol |
| SMILES | CCC(C)C1(O)CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H28O/c1-7-11(2)14(15)9-12(3,4)8-13(5,6)10-14/h11,15H,7-10H2,1-6H3 |
| InChIKey | LACPSCWVIVHJAW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |