C15H24N2O — CID 112682728
1-(2-amino-3-pyridinyl)-3,3,5,5-tetramethylcyclohexan-1-ol (PubChem CID 112682728) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-(2-amino-3-pyridinyl)-3,3,5,5-tetramethylcyclohexan-1-ol.
| Compound Name | 1-(2-amino-3-pyridinyl)-3,3,5,5-tetramethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 112682728 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1-(2-amino-3-pyridinyl)-3,3,5,5-tetramethylcyclohexan-1-ol |
| SMILES | CC1(C)CC(C)(C)CC(O)(c2cccnc2N)C1 |
| InChI | InChI=1S/C15H24N2O/c1-13(2)8-14(3,4)10-15(18,9-13)11-6-5-7-17-12(11)16/h5-7,18H,8-10H2,1-4H3,(H2,16,17) |
| InChIKey | NPBPMHRAHUUZMF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |