C12H17ClN2O3 — CID 112683112
2-[(5-chlorofuran-2-yl)methylamino]-1-morpholin-4-ylpropan-1-one (PubChem CID 112683112) has the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. Its IUPAC name is 2-[(5-chlorofuran-2-yl)methylamino]-1-morpholin-4-ylpropan-1-one.
| Compound Name | 2-[(5-chlorofuran-2-yl)methylamino]-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 112683112 |
| Molecular Formula | C12H17ClN2O3 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-[(5-chlorofuran-2-yl)methylamino]-1-morpholin-4-ylpropan-1-one |
| SMILES | CC(NCc1ccc(Cl)o1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C12H17ClN2O3/c1-9(12(16)15-4-6-17-7-5-15)14-8-10-2-3-11(13)18-10/h2-3,9,14H,4-8H2,1H3 |
| InChIKey | BMGNORZIWYKIPJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |