C11H13F5N2 — CID 112683482
N',N'-dimethyl-N-[(2,3,4,5,6-pentafluorophenyl)methyl]ethane-1,2-diamine (PubChem CID 112683482) has the molecular formula C11H13F5N2 and a molecular weight of 268.23 g/mol. Its IUPAC name is N',N'-dimethyl-N-[(2,3,4,5,6-pentafluorophenyl)methyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[(2,3,4,5,6-pentafluorophenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 112683482 |
| Molecular Formula | C11H13F5N2 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N',N'-dimethyl-N-[(2,3,4,5,6-pentafluorophenyl)methyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H13F5N2/c1-18(2)4-3-17-5-6-7(12)9(14)11(16)10(15)8(6)13/h17H,3-5H2,1-2H3 |
| InChIKey | LYCYBAUJMNJUJZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|