C23H31FO2 — CID 11268350
(1R,2R,4aS,5R)-5-[(E)-3-(4-fluorophenyl)prop-2-enyl]-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol (PubChem CID 11268350) has the molecular formula C23H31FO2 and a molecular weight of 358.50 g/mol. Its IUPAC name is (1R,2R,4aS,5R)-5-[(E)-3-(4-fluorophenyl)prop-2-enyl]-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol.
| Compound Name | (1R,2R,4aS,5R)-5-[(E)-3-(4-fluorophenyl)prop-2-enyl]-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 11268350 |
| Molecular Formula | C23H31FO2 |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | (1R,2R,4aS,5R)-5-[(E)-3-(4-fluorophenyl)prop-2-enyl]-1-(hydroxymethyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
| SMILES | C=C1CCC2[C@](C)(CO)[C@H](O)CC[C@@]2(C)[C@@H]1C/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C23H31FO2/c1-16-7-12-20-22(2,14-13-21(26)23(20,3)15-25)19(16)6-4-5-17-8-10-18(24)11-9-17/h4-5,8-11,19-21,25-26H,1,6-7,12-15H2,2-3H3/b5-4+/t19-,20?,21-,22+,23+/m1/s1 |
| InChIKey | CLLLDFJAMNJCBN-QZXNJAFPSA-N |
| XLogP | 4.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|