C19H24N2O5 — CID 11268404
[(E)-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)but-2-enyl] 2-(4-methoxyphenyl)acetate (PubChem CID 11268404) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is [(E)-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)but-2-enyl] 2-(4-methoxyphenyl)acetate.
| Compound Name | [(E)-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)but-2-enyl] 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 11268404 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | [(E)-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)but-2-enyl] 2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OC/C=C/CN2C(=O)N(C)C(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C19H24N2O5/c1-19(2)17(23)21(18(24)20(19)3)11-5-6-12-26-16(22)13-14-7-9-15(25-4)10-8-14/h5-10H,11-13H2,1-4H3/b6-5+ |
| InChIKey | WYJUYVMOSUMZNT-AATRIKPKSA-N |
| XLogP | 2.01 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|