About 1-(dimethylamino)-2,2-dimethyl-3-(sulfamoylamino)propane
1-(dimethylamino)-2,2-dimethyl-3-(sulfamoylamino)propane (PubChem CID 112684055) has the molecular formula C7H19N3O2S
and a molecular weight of 209.31 g/mol. Its IUPAC name is 1-(dimethylamino)-2,2-dimethyl-3-(sulfamoylamino)propane.
Molecular Properties
| Compound Name | 1-(dimethylamino)-2,2-dimethyl-3-(sulfamoylamino)propane |
| PubChem CID | 112684055 |
| Molecular Formula | C7H19N3O2S |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-(dimethylamino)-2,2-dimethyl-3-(sulfamoylamino)propane |
| SMILES | CN(C)CC(C)(C)CNS(N)(=O)=O |
| InChI | InChI=1S/C7H19N3O2S/c1-7(2,6-10(3)4)5-9-13(8,11)12/h9H,5-6H2,1-4H3,(H2,8,11,12) |
| InChIKey | MKRSEJMUCSQESM-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(dimethylamino)-2,2-dimethyl-3-(sulfamoylamino)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)-2,2-dimethyl-3-(sulfamoylamino)propane?
The IUPAC name of 1-(dimethylamino)-2,2-dimethyl-3-(sulfamoylamino)propane (CID 112684055) is 1-(dimethylamino)-2,2-dimethyl-3-(sulfamoylamino)propane.
What is the SMILES notation for 1-(dimethylamino)-2,2-dimethyl-3-(sulfamoylamino)propane?
The canonical SMILES for 1-(dimethylamino)-2,2-dimethyl-3-(sulfamoylamino)propane is CN(C)CC(C)(C)CNS(N)(=O)=O.
What is the InChIKey of 1-(dimethylamino)-2,2-dimethyl-3-(sulfamoylamino)propane?
The InChIKey is MKRSEJMUCSQESM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H19N3O2S/c1-7(2,6-10(3)4)5-9-13(8,11)12/h9H,5-6H2,1-4H3,(H2,8,11,12).
What are the key properties of 1-(dimethylamino)-2,2-dimethyl-3-(sulfamoylamino)propane?
1-(dimethylamino)-2,2-dimethyl-3-(sulfamoylamino)propane has a molecular weight of 209.31 g/mol, XLogP of -0.63, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)-2,2-dimethyl-3-(sulfamoylamino)propane is sourced from PubChem (CID 112684055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).