About methyl 2-[(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]acetate
methyl 2-[(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]acetate (PubChem CID 11268504) has the molecular formula C20H33NO3Si
and a molecular weight of 363.57 g/mol. Its IUPAC name is methyl 2-[(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]acetate |
| PubChem CID | 11268504 |
| Molecular Formula | C20H33NO3Si |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | methyl 2-[(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1Cc1ccccc1 |
| InChI | InChI=1S/C20H33NO3Si/c1-20(2,3)25(5,6)24-18-12-17(13-19(22)23-4)21(15-18)14-16-10-8-7-9-11-16/h7-11,17-18H,12-15H2,1-6H3/t17-,18+/m0/s1 |
| InChIKey | ALPJOIISPMHCJO-ZWKOTPCHSA-N |
| XLogP | 4.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]acetate?
The IUPAC name of methyl 2-[(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]acetate (CID 11268504) is methyl 2-[(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]acetate.
What is the SMILES notation for methyl 2-[(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]acetate?
The canonical SMILES for methyl 2-[(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]acetate is COC(=O)C[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1Cc1ccccc1.
What is the InChIKey of methyl 2-[(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]acetate?
The InChIKey is ALPJOIISPMHCJO-ZWKOTPCHSA-N. The full InChI is InChI=1S/C20H33NO3Si/c1-20(2,3)25(5,6)24-18-12-17(13-19(22)23-4)21(15-18)14-16-10-8-7-9-11-16/h7-11,17-18H,12-15H2,1-6H3/t17-,18+/m0/s1.
What are the key properties of methyl 2-[(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]acetate?
methyl 2-[(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]acetate has a molecular weight of 363.57 g/mol, XLogP of 4.21, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]acetate is sourced from PubChem (CID 11268504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).