C19H24ClFN2O2 — CID 11268584
2-tert-butyl-4-chloro-5-[[4-(4-(18F)fluorobutyl)phenyl]methoxy]pyridazin-3-one (PubChem CID 11268584) has the molecular formula C19H24ClFN2O2 and a molecular weight of 365.87 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-[[4-(4-(18F)fluorobutyl)phenyl]methoxy]pyridazin-3-one.
| Compound Name | 2-tert-butyl-4-chloro-5-[[4-(4-(18F)fluorobutyl)phenyl]methoxy]pyridazin-3-one |
|---|---|
| PubChem CID | 11268584 |
| Molecular Formula | C19H24ClFN2O2 |
| Molecular Weight | 365.87 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-[[4-(4-(18F)fluorobutyl)phenyl]methoxy]pyridazin-3-one |
| SMILES | CC(C)(C)n1ncc(OCc2ccc(CCCC[18F])cc2)c(Cl)c1=O |
| InChI | InChI=1S/C19H24ClFN2O2/c1-19(2,3)23-18(24)17(20)16(12-22-23)25-13-15-9-7-14(8-10-15)6-4-5-11-21/h7-10,12H,4-6,11,13H2,1-3H3/i21-1 |
| InChIKey | KXTQTSAQSJMKLA-GJQNQZCXSA-N |
| XLogP | 4.52 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.87 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|