C12H11ClN2O2S — CID 112686413
3-chloro-4-cyano-N-ethyl-N-prop-2-ynylbenzenesulfonamide (PubChem CID 112686413) has the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-ethyl-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | 3-chloro-4-cyano-N-ethyl-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 112686413 |
| Molecular Formula | C12H11ClN2O2S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 3-chloro-4-cyano-N-ethyl-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCN(CC)S(=O)(=O)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C12H11ClN2O2S/c1-3-7-15(4-2)18(16,17)11-6-5-10(9-14)12(13)8-11/h1,5-6,8H,4,7H2,2H3 |
| InChIKey | XONJRQSHFITNML-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|