About 3-nitro-4-(3,3,3-trifluoropropoxy)benzonitrile
3-nitro-4-(3,3,3-trifluoropropoxy)benzonitrile (PubChem CID 112687406) has the molecular formula C10H7F3N2O3
and a molecular weight of 260.17 g/mol. Its IUPAC name is 3-nitro-4-(3,3,3-trifluoropropoxy)benzonitrile.
Molecular Properties
| Compound Name | 3-nitro-4-(3,3,3-trifluoropropoxy)benzonitrile |
| PubChem CID | 112687406 |
| Molecular Formula | C10H7F3N2O3 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 3-nitro-4-(3,3,3-trifluoropropoxy)benzonitrile |
| SMILES | N#Cc1ccc(OCCC(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H7F3N2O3/c11-10(12,13)3-4-18-9-2-1-7(6-14)5-8(9)15(16)17/h1-2,5H,3-4H2 |
| InChIKey | SAZIFECMKIWTIA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-4-(3,3,3-trifluoropropoxy)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-4-(3,3,3-trifluoropropoxy)benzonitrile?
The IUPAC name of 3-nitro-4-(3,3,3-trifluoropropoxy)benzonitrile (CID 112687406) is 3-nitro-4-(3,3,3-trifluoropropoxy)benzonitrile.
What is the SMILES notation for 3-nitro-4-(3,3,3-trifluoropropoxy)benzonitrile?
The canonical SMILES for 3-nitro-4-(3,3,3-trifluoropropoxy)benzonitrile is N#Cc1ccc(OCCC(F)(F)F)c([N+](=O)[O-])c1.
What is the InChIKey of 3-nitro-4-(3,3,3-trifluoropropoxy)benzonitrile?
The InChIKey is SAZIFECMKIWTIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F3N2O3/c11-10(12,13)3-4-18-9-2-1-7(6-14)5-8(9)15(16)17/h1-2,5H,3-4H2.
What are the key properties of 3-nitro-4-(3,3,3-trifluoropropoxy)benzonitrile?
3-nitro-4-(3,3,3-trifluoropropoxy)benzonitrile has a molecular weight of 260.17 g/mol, XLogP of 2.80, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-4-(3,3,3-trifluoropropoxy)benzonitrile is sourced from PubChem (CID 112687406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).