C16H24O10 — CID 11268875
methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-propan-2-yloxyoxane-2-carboxylate (PubChem CID 11268875) has the molecular formula C16H24O10 and a molecular weight of 376.36 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-propan-2-yloxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-propan-2-yloxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 11268875 |
| Molecular Formula | C16H24O10 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-propan-2-yloxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](OC(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H24O10/c1-7(2)22-16-14(25-10(5)19)12(24-9(4)18)11(23-8(3)17)13(26-16)15(20)21-6/h7,11-14,16H,1-6H3/t11-,12-,13-,14+,16+/m0/s1 |
| InChIKey | WMLVFLHCFASTLY-GRYWWWGRSA-N |
| XLogP | 0.10 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|