C5H11N3O4S — CID 112689179
4-hydroxy-1-sulfamoylpyrrolidine-2-carboxamide (PubChem CID 112689179) has the molecular formula C5H11N3O4S and a molecular weight of 209.23 g/mol. Its IUPAC name is 4-hydroxy-1-sulfamoylpyrrolidine-2-carboxamide.
| Compound Name | 4-hydroxy-1-sulfamoylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 112689179 |
| Molecular Formula | C5H11N3O4S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 4-hydroxy-1-sulfamoylpyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CC(O)CN1S(N)(=O)=O |
| InChI | InChI=1S/C5H11N3O4S/c6-5(10)4-1-3(9)2-8(4)13(7,11)12/h3-4,9H,1-2H2,(H2,6,10)(H2,7,11,12) |
| InChIKey | YRITZCPCGHIJQH-UHFFFAOYSA-N |
| XLogP | -2.89 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |