C8H12N2O3S — CID 112689195
1-hydroxy-4-[[methyl(sulfamoyl)amino]methyl]benzene (PubChem CID 112689195) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 1-hydroxy-4-[[methyl(sulfamoyl)amino]methyl]benzene.
| Compound Name | 1-hydroxy-4-[[methyl(sulfamoyl)amino]methyl]benzene |
|---|---|
| PubChem CID | 112689195 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1-hydroxy-4-[[methyl(sulfamoyl)amino]methyl]benzene |
| SMILES | CN(Cc1ccc(O)cc1)S(N)(=O)=O |
| InChI | InChI=1S/C8H12N2O3S/c1-10(14(9,12)13)6-7-2-4-8(11)5-3-7/h2-5,11H,6H2,1H3,(H2,9,12,13) |
| InChIKey | ZNCKGVKGADCZBF-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |