C8H19N3O3S — CID 112689198
4-[2-hydroxyethyl(sulfamoyl)amino]-1-methylpiperidine (PubChem CID 112689198) has the molecular formula C8H19N3O3S and a molecular weight of 237.32 g/mol. Its IUPAC name is 4-[2-hydroxyethyl(sulfamoyl)amino]-1-methylpiperidine.
| Compound Name | 4-[2-hydroxyethyl(sulfamoyl)amino]-1-methylpiperidine |
|---|---|
| PubChem CID | 112689198 |
| Molecular Formula | C8H19N3O3S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 4-[2-hydroxyethyl(sulfamoyl)amino]-1-methylpiperidine |
| SMILES | CN1CCC(N(CCO)S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C8H19N3O3S/c1-10-4-2-8(3-5-10)11(6-7-12)15(9,13)14/h8,12H,2-7H2,1H3,(H2,9,13,14) |
| InChIKey | OSICDWLTYQEXBN-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |