C18H18N8O2 — CID 11268940
(1R,2R)-1,2-bis(2-benzyltetrazol-5-yl)ethane-1,2-diol (PubChem CID 11268940) has the molecular formula C18H18N8O2 and a molecular weight of 378.40 g/mol. Its IUPAC name is (1R,2R)-1,2-bis(2-benzyltetrazol-5-yl)ethane-1,2-diol.
| Compound Name | (1R,2R)-1,2-bis(2-benzyltetrazol-5-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 11268940 |
| Molecular Formula | C18H18N8O2 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (1R,2R)-1,2-bis(2-benzyltetrazol-5-yl)ethane-1,2-diol |
| SMILES | O[C@H](c1nnn(Cc2ccccc2)n1)[C@H](O)c1nnn(Cc2ccccc2)n1 |
| InChI | InChI=1S/C18H18N8O2/c27-15(17-19-23-25(21-17)11-13-7-3-1-4-8-13)16(28)18-20-24-26(22-18)12-14-9-5-2-6-10-14/h1-10,15-16,27-28H,11-12H2/t15-,16-/m0/s1 |
| InChIKey | PBHVFNKNCLUWES-HOTGVXAUSA-N |
| XLogP | 0.52 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |