C14H12Cl2FNO4S — CID 11268986
(1R,2S,3R,5R,6R)-2-amino-3-(3,4-dichlorophenyl)sulfanyl-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 11268986) has the molecular formula C14H12Cl2FNO4S and a molecular weight of 380.22 g/mol. Its IUPAC name is (1R,2S,3R,5R,6R)-2-amino-3-(3,4-dichlorophenyl)sulfanyl-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | (1R,2S,3R,5R,6R)-2-amino-3-(3,4-dichlorophenyl)sulfanyl-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 11268986 |
| Molecular Formula | C14H12Cl2FNO4S |
| Molecular Weight | 380.22 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | (1R,2S,3R,5R,6R)-2-amino-3-(3,4-dichlorophenyl)sulfanyl-6-fluorobicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | N[C@]1(C(=O)O)[C@H]2[C@@H](C[C@H]1Sc1ccc(Cl)c(Cl)c1)[C@]2(F)C(=O)O |
| InChI | InChI=1S/C14H12Cl2FNO4S/c15-7-2-1-5(3-8(7)16)23-9-4-6-10(13(6,17)11(19)20)14(9,18)12(21)22/h1-3,6,9-10H,4,18H2,(H,19,20)(H,21,22)/t6-,9-,10+,13-,14+/m1/s1 |
| InChIKey | AHPCTMJLRHKGCX-BSHPRBNJSA-N |
| XLogP | 2.68 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |