About 7-chloro-2-[(2,4-difluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide
7-chloro-2-[(2,4-difluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide (PubChem CID 11269070) has the molecular formula C16H9ClF2N2O3S
and a molecular weight of 382.78 g/mol. Its IUPAC name is 7-chloro-2-[(2,4-difluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide.
Molecular Properties
| Compound Name | 7-chloro-2-[(2,4-difluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide |
| PubChem CID | 11269070 |
| Molecular Formula | C16H9ClF2N2O3S |
| Molecular Weight | 382.78 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 7-chloro-2-[(2,4-difluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)c2ccc(F)cc2F)sc2c(Cl)c(O)ccc12 |
| InChI | InChI=1S/C16H9ClF2N2O3S/c17-12-10(22)4-3-8-11(14(20)23)16(25-13(8)12)21-15(24)7-2-1-6(18)5-9(7)19/h1-5,22H,(H2,20,23)(H,21,24) |
| InChIKey | HCXQRWIWDYKRMP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.78 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloro-2-[(2,4-difluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-[(2,4-difluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide?
The IUPAC name of 7-chloro-2-[(2,4-difluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide (CID 11269070) is 7-chloro-2-[(2,4-difluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide.
What is the SMILES notation for 7-chloro-2-[(2,4-difluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide?
The canonical SMILES for 7-chloro-2-[(2,4-difluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide is NC(=O)c1c(NC(=O)c2ccc(F)cc2F)sc2c(Cl)c(O)ccc12.
What is the InChIKey of 7-chloro-2-[(2,4-difluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide?
The InChIKey is HCXQRWIWDYKRMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9ClF2N2O3S/c17-12-10(22)4-3-8-11(14(20)23)16(25-13(8)12)21-15(24)7-2-1-6(18)5-9(7)19/h1-5,22H,(H2,20,23)(H,21,24).
What are the key properties of 7-chloro-2-[(2,4-difluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide?
7-chloro-2-[(2,4-difluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide has a molecular weight of 382.78 g/mol, XLogP of 3.89, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-[(2,4-difluorobenzoyl)amino]-6-hydroxy-1-benzothiophene-3-carboxamide is sourced from PubChem (CID 11269070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).