About 4-(2,3-dihydro-1-benzofuran-4-ylamino)-6-methylsulfonylquinoline-3-carboxamide
4-(2,3-dihydro-1-benzofuran-4-ylamino)-6-methylsulfonylquinoline-3-carboxamide (PubChem CID 11269083) has the molecular formula C19H17N3O4S
and a molecular weight of 383.43 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-4-ylamino)-6-methylsulfonylquinoline-3-carboxamide.
Molecular Properties
| Compound Name | 4-(2,3-dihydro-1-benzofuran-4-ylamino)-6-methylsulfonylquinoline-3-carboxamide |
| PubChem CID | 11269083 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-4-ylamino)-6-methylsulfonylquinoline-3-carboxamide |
| SMILES | CS(=O)(=O)c1ccc2ncc(C(N)=O)c(Nc3cccc4c3CCO4)c2c1 |
| InChI | InChI=1S/C19H17N3O4S/c1-27(24,25)11-5-6-15-13(9-11)18(14(10-21-15)19(20)23)22-16-3-2-4-17-12(16)7-8-26-17/h2-6,9-10H,7-8H2,1H3,(H2,20,23)(H,21,22) |
| InChIKey | PAHFUSOOJGKHIO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2,3-dihydro-1-benzofuran-4-ylamino)-6-methylsulfonylquinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dihydro-1-benzofuran-4-ylamino)-6-methylsulfonylquinoline-3-carboxamide?
The IUPAC name of 4-(2,3-dihydro-1-benzofuran-4-ylamino)-6-methylsulfonylquinoline-3-carboxamide (CID 11269083) is 4-(2,3-dihydro-1-benzofuran-4-ylamino)-6-methylsulfonylquinoline-3-carboxamide.
What is the SMILES notation for 4-(2,3-dihydro-1-benzofuran-4-ylamino)-6-methylsulfonylquinoline-3-carboxamide?
The canonical SMILES for 4-(2,3-dihydro-1-benzofuran-4-ylamino)-6-methylsulfonylquinoline-3-carboxamide is CS(=O)(=O)c1ccc2ncc(C(N)=O)c(Nc3cccc4c3CCO4)c2c1.
What is the InChIKey of 4-(2,3-dihydro-1-benzofuran-4-ylamino)-6-methylsulfonylquinoline-3-carboxamide?
The InChIKey is PAHFUSOOJGKHIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O4S/c1-27(24,25)11-5-6-15-13(9-11)18(14(10-21-15)19(20)23)22-16-3-2-4-17-12(16)7-8-26-17/h2-6,9-10H,7-8H2,1H3,(H2,20,23)(H,21,22).
What are the key properties of 4-(2,3-dihydro-1-benzofuran-4-ylamino)-6-methylsulfonylquinoline-3-carboxamide?
4-(2,3-dihydro-1-benzofuran-4-ylamino)-6-methylsulfonylquinoline-3-carboxamide has a molecular weight of 383.43 g/mol, XLogP of 2.42, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydro-1-benzofuran-4-ylamino)-6-methylsulfonylquinoline-3-carboxamide is sourced from PubChem (CID 11269083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).