C22H20N6O — CID 11269112
6-pyridin-3-yl-9-(pyridin-2-ylmethoxy)-4,5,7,8-tetrazatetracyclo[9.2.2.02,10.03,7]pentadeca-2(10),3,5,8-tetraene (PubChem CID 11269112) has the molecular formula C22H20N6O and a molecular weight of 384.44 g/mol. Its IUPAC name is 6-pyridin-3-yl-9-(pyridin-2-ylmethoxy)-4,5,7,8-tetrazatetracyclo[9.2.2.02,10.03,7]pentadeca-2(10),3,5,8-tetraene.
| Compound Name | 6-pyridin-3-yl-9-(pyridin-2-ylmethoxy)-4,5,7,8-tetrazatetracyclo[9.2.2.02,10.03,7]pentadeca-2(10),3,5,8-tetraene |
|---|---|
| PubChem CID | 11269112 |
| Molecular Formula | C22H20N6O |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 6-pyridin-3-yl-9-(pyridin-2-ylmethoxy)-4,5,7,8-tetrazatetracyclo[9.2.2.02,10.03,7]pentadeca-2(10),3,5,8-tetraene |
| SMILES | c1ccc(COc2nn3c(-c4cccnc4)nnc3c3c2C2CCC3CC2)nc1 |
| InChI | InChI=1S/C22H20N6O/c1-2-11-24-17(5-1)13-29-22-19-15-8-6-14(7-9-15)18(19)21-26-25-20(28(21)27-22)16-4-3-10-23-12-16/h1-5,10-12,14-15H,6-9,13H2 |
| InChIKey | OGZWYHFVQMYPED-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 78.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |