C19H36O4Si2 — CID 11269139
(1R,2R,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-triethylsilyloxy-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 11269139) has the molecular formula C19H36O4Si2 and a molecular weight of 384.67 g/mol. Its IUPAC name is (1R,2R,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-triethylsilyloxy-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,2R,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-triethylsilyloxy-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 11269139 |
| Molecular Formula | C19H36O4Si2 |
| Molecular Weight | 384.67 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (1R,2R,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-triethylsilyloxy-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C19H36O4Si2/c1-9-25(10-2,11-3)23-18-15-13-12-14(21-15)17(16(18)20)22-24(7,8)19(4,5)6/h12-15,17-18H,9-11H2,1-8H3/t14-,15+,17-,18+/m1/s1 |
| InChIKey | IGXSMQMDOOTVMJ-ATLSCFEFSA-N |
| XLogP | 4.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.67 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|