C22H44O3Si — CID 11269140
tert-butyl-[[(4R,5R)-5-[(E,2S,4R)-4,6-dimethyloct-6-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane (PubChem CID 11269140) has the molecular formula C22H44O3Si and a molecular weight of 384.68 g/mol. Its IUPAC name is tert-butyl-[[(4R,5R)-5-[(E,2S,4R)-4,6-dimethyloct-6-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4R,5R)-5-[(E,2S,4R)-4,6-dimethyloct-6-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11269140 |
| Molecular Formula | C22H44O3Si |
| Molecular Weight | 384.68 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | tert-butyl-[[(4R,5R)-5-[(E,2S,4R)-4,6-dimethyloct-6-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane |
| SMILES | C/C=C(\C)C[C@H](C)C[C@H](C)[C@H]1OC(C)(C)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O3Si/c1-12-16(2)13-17(3)14-18(4)20-19(24-22(8,9)25-20)15-23-26(10,11)21(5,6)7/h12,17-20H,13-15H2,1-11H3/b16-12+/t17-,18-,19+,20+/m0/s1 |
| InChIKey | BYVKYMIOUHASFS-DSUBFKPQSA-N |
| XLogP | 6.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.68 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|