C11H16N4O2 — CID 112691898
5-[[(4-methoxy-6-methylpyrimidin-2-yl)amino]methyl]pyrrolidin-2-one (PubChem CID 112691898) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 5-[[(4-methoxy-6-methylpyrimidin-2-yl)amino]methyl]pyrrolidin-2-one.
| Compound Name | 5-[[(4-methoxy-6-methylpyrimidin-2-yl)amino]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 112691898 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 5-[[(4-methoxy-6-methylpyrimidin-2-yl)amino]methyl]pyrrolidin-2-one |
| SMILES | COc1cc(C)nc(NCC2CCC(=O)N2)n1 |
| InChI | InChI=1S/C11H16N4O2/c1-7-5-10(17-2)15-11(13-7)12-6-8-3-4-9(16)14-8/h5,8H,3-4,6H2,1-2H3,(H,14,16)(H,12,13,15) |
| InChIKey | SVTDKVXMPPUJSO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |