C20H25N3O5 — CID 11269207
3-hydroxy-N-[(2S,3R)-3-hydroxy-1-(N-(2-hydroxyethylamino)anilino)-1-oxobutan-2-yl]-2-methylbenzamide (PubChem CID 11269207) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-hydroxy-N-[(2S,3R)-3-hydroxy-1-(N-(2-hydroxyethylamino)anilino)-1-oxobutan-2-yl]-2-methylbenzamide.
| Compound Name | 3-hydroxy-N-[(2S,3R)-3-hydroxy-1-(N-(2-hydroxyethylamino)anilino)-1-oxobutan-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 11269207 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 3-hydroxy-N-[(2S,3R)-3-hydroxy-1-(N-(2-hydroxyethylamino)anilino)-1-oxobutan-2-yl]-2-methylbenzamide |
| SMILES | Cc1c(O)cccc1C(=O)N[C@H](C(=O)N(NCCO)c1ccccc1)[C@@H](C)O |
| InChI | InChI=1S/C20H25N3O5/c1-13-16(9-6-10-17(13)26)19(27)22-18(14(2)25)20(28)23(21-11-12-24)15-7-4-3-5-8-15/h3-10,14,18,21,24-26H,11-12H2,1-2H3,(H,22,27)/t14-,18+/m1/s1 |
| InChIKey | FJCNUKMVPYTEOK-KDOFPFPSSA-N |
| XLogP | 0.71 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|