C13H16FNO2 — CID 112692568
1-[2-fluoro-6-[3-(hydroxymethyl)pyrrolidin-1-yl]phenyl]ethanone (PubChem CID 112692568) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is 1-[2-fluoro-6-[3-(hydroxymethyl)pyrrolidin-1-yl]phenyl]ethanone.
| Compound Name | 1-[2-fluoro-6-[3-(hydroxymethyl)pyrrolidin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 112692568 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-[2-fluoro-6-[3-(hydroxymethyl)pyrrolidin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1c(F)cccc1N1CCC(CO)C1 |
| InChI | InChI=1S/C13H16FNO2/c1-9(17)13-11(14)3-2-4-12(13)15-6-5-10(7-15)8-16/h2-4,10,16H,5-8H2,1H3 |
| InChIKey | CBZKOOZXTQORGL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |