About 2-amino-5-butyl-1,3-oxazol-4-one
2-amino-5-butyl-1,3-oxazol-4-one (PubChem CID 112693093) has the molecular formula C7H12N2O2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 2-amino-5-butyl-1,3-oxazol-4-one.
Molecular Properties
| Compound Name | 2-amino-5-butyl-1,3-oxazol-4-one |
| PubChem CID | 112693093 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 2-amino-5-butyl-1,3-oxazol-4-one |
| SMILES | CCCCC1OC(N)=NC1=O |
| InChI | InChI=1S/C7H12N2O2/c1-2-3-4-5-6(10)9-7(8)11-5/h5H,2-4H2,1H3,(H2,8,9,10) |
| InChIKey | OBJSFRMZRXZXRW-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-5-butyl-1,3-oxazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-butyl-1,3-oxazol-4-one?
The IUPAC name of 2-amino-5-butyl-1,3-oxazol-4-one (CID 112693093) is 2-amino-5-butyl-1,3-oxazol-4-one.
What is the SMILES notation for 2-amino-5-butyl-1,3-oxazol-4-one?
The canonical SMILES for 2-amino-5-butyl-1,3-oxazol-4-one is CCCCC1OC(N)=NC1=O.
What is the InChIKey of 2-amino-5-butyl-1,3-oxazol-4-one?
The InChIKey is OBJSFRMZRXZXRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-2-3-4-5-6(10)9-7(8)11-5/h5H,2-4H2,1H3,(H2,8,9,10).
What are the key properties of 2-amino-5-butyl-1,3-oxazol-4-one?
2-amino-5-butyl-1,3-oxazol-4-one has a molecular weight of 156.19 g/mol, XLogP of 0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-butyl-1,3-oxazol-4-one is sourced from PubChem (CID 112693093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).